1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic acid. CH3CH2CH2COOH+CH3CH(CH3)NH2⟶

2.)Give the systematic (IUPAC) names for these molecules.

This molecule has the condensed formula C H 3 C H 2 C O O (C 6 H 5). C 6 H 5 is a benzene ring.

IUPAC name

ch3 [ch2]14cooh

explanation:

periodic trends is an atom that gets larger as the number of electronic shells increase, the radius of atoms increases as you go down a certain group in the periodic table of elements. in general, the size of an atom will decrease as you move from left to right of a certain period.

answerto predict;