Chemistry, 23.02.2021 20:30 sosa1k18

Photolithography is the process by which we make the tiny circuits necessary for the tiny transistors in today’s electronics. To do this we must create very thin films of a chemical burn carveout channels that are filled with metal to creat the circuits. One posible candidate for making these thin films is butyltin trichloride, C4H9SnCl3. In the presence water this chemical loosens some of its bound chloride atoms producing hydrochloric acid HCI, arrording to the chemical equation below C4H9SnCl3+H2O=C4H9Sn(OH)2Cl+HCl

Answers: 3

Show answers

Other questions on the subject: Chemistry

Chemistry, 22.06.2019 17:10, mikeeway33

Some liquids can be distilled, but only at temperatures that are so high that it is impractical, or so high the compound decomposes. explain why distillation such compounds at significantly less than atmospheric pressure (some degree of vacuum) would solve this problem.

Answers: 2

continue

Chemistry, 23.06.2019 02:00, hannabeth91

When an experimenter draws a conclusion that he assumes will apply to all situations set up similarly to his test situation, even though he cannot possibly have examined all possible test scenarios, the experimenter is using deductive reasoning inductive reasoning abductive reasoning subjective reasoning

Answers: 1

continue

Chemistry, 23.06.2019 03:20, coollid876

High-pressure liquid chromatography (hplc) is a method used in chemistry and biochemistry to purify chemical substances. the pressures used in this procedure range from around 500 kilopascals (500,000 pa) to about 60,000 kpa (60,000,000 pa). it is often convenient to know the pressure in torr. if an hplc procedure is running at a pressure of 1.03×108 pa , what is its running pressure in torr?

Answers: 3

continue

Chemistry, 23.06.2019 08:00, mackaylabarnes22

Ineed this awnser fast select the correct answer. this chemical equation represents the burning of methane, but the equation is incomplete. what is the missing coefficient in both the reactants and the products? ch4 + → co2 + a. 0 b. 1c. 2d. 3 e. 4

Answers: 3

continue

You know the right answer?

Photolithography is the process by which we make the tiny circuits necessary for the tiny transistor...