What is the IUPAC name for
Ch3Ch(Cl)Ch2Ch(Ch3)Ch2Ch3

Asample of ammonia reacts with oxygen as shown. 4nh3(g) + 5o2(g) 4no(g) + 6h2o(g) what is the limiting reactant if 4.0 g of nh3 react with 8.0 g of oxygen? o2 because it produces only 0.20 mol of no. nh3 because it produces only 0.20 mol of no. o2 because it produces two times less no than nh3. nh3 because it produces three times more no than o2.

How does the atmosphere to make earth livable? check all that apply. causes the seasons contains oxygen provides warmth creates important nutrients blocks harmful energy from the sun plz like !

If 16.00g of hydrogen gas reacts with 126.73g of oxygen, how many grams of water are yielded? (both reactants are completely consumed in the reaction.)