Select any and all of these molecules that have at least one chiral carbon atom. Group of answer choices 3,4-dimethylhexane 3,3-dimethylpentane CH3CH2CH(OH)CH3 CH3CH2CH(CH3)CH2CH2CH3 CH3C(CH3)2CH(CH2CH3)C(CH3)3

3,4-dimethylhexane, CH3CH2CH(OH)CH3, CH3CH2CH(CH3)CH2CH2CH3

Explanation:

A chiral carbon atom is also referred to as a asymmetric carbon atom. This is a carbon atom that is bonded to four different substituents.

So what we need to do is to look at each compound and consider all the carbon atoms in each compound. Drawing out the full structural formula is very helpful here.

After drawing each structure out, we now look out for carbon atoms that have four dissimilar substituents. Those are the chiral carbons. If we do so for all the molecules listed in the answer, we will discover that each of them contains an asymmetric carbon atom.

1.consider the following balanced equation and answer parts a through. show calculations for each part.  

3 ag(s) + 4 hno3(aq) → 3 agno3(aq) + no(g) + 2 h2o(l)  

a. calculate the number of moles of agno3 produced by the reaction of 3 moles of ag with excess hno3. if the number to the left of the compound represents the number of moles of the compound which are present, then 3 moles of ag react with 4 moles hno3 to produce 3 moles agno3 (aq).

so the answer to a would be 3 moles.

b. calculate the number of moles of agno3 produced by the reaction of 108 grams of ag with excess hno3.  

i'm not sure how to plug in the grams of silver into an equation using moles to find how many moles are produced.

c. calculate the number of grams of agno3 produced by the reaction of 108 grams of ag with excess hno3  

d. calculate the number of moles of no produced as a byproduct of the reaction of 108 grams of ag with excess hno3.  

e. calculate the number of grams of no produced as a byproduct starting with 108 grams of ag and excess hno3.  

explanation: