Name the following compound from the concise formula:. CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

b. acid is the correct answer @jayxboof all social media

acid : acids are those which accepts an electron-pairs.

base : bases are those which donates ab electron-pairs.

alkali : it is a base that dissolves in water. it is basically a base and the ph greater than 7.

hydroxide ion : it is a poly-atomic ion which is negatively charged.

it’s previous models   because when i picked that son of a gun’s answer it was wrong look for previous models because they might make it a different letter