Chemistry, 31.12.2019 05:31 martdrea13

What is the molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid.

caco3(s)+2ch3cooh(aq) → ca(ch3coo)2(aq)+h2o(l)+co2(g)

caco3(s)+ch3cooh(aq) → cach3coo(aq)+h2o(l)+co2(g)

caco3(s)+2ch3cooh(aq) → ca(ch3coo)2(s)+h2o(l)+co2(g)

caco3(s)+ch3cooh(aq) → cach3coo(s)+h2o(l)+co2(g)

Answers: 3

Show answers

Other questions on the subject: Chemistry

Chemistry, 21.06.2019 18:00, thechocolatblanc

During which movies do spring tides new moon first quarter waxing gibbous waxing

Answers: 1

continue

Chemistry, 21.06.2019 22:30, dinosaur10

Complete the sentence. the lower the hydrogen ion concentration, the the ph. higher lower closer to 7 closer to 0

Answers: 2

continue

Chemistry, 22.06.2019 13:00, yaneiryx5476

Is 9 correct? and can someone me with 10? it’s due tomorrow, you

Answers: 1

continue

Chemistry, 22.06.2019 14:50, wcraig1998

Complete the following statements to describe solids, liquids, and gases. select the correct answer from each drop-down menu. a solid a definite volume and a definite shape. a liquid a definite volume and a definite shape. a gas a definite volume and a definite shape

Answers: 1

continue

You know the right answer?

What is the molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid....