The chelate effect can be partially explained in terms of the entropy change involved in chelation reactions. the reaction forming coedta? from the hexaaqua complex of co3+,co(h2o)63+(aq) + edta4-(aq) ? coedta-(aq)+ 6h2o(l)leads to a net increase in the number of particles in the solution. part a: in which of the following reactions will the entropy change, ? s, be a positive value? a. caedta? (aq)+3en(aq)? ca(en)33(aq)+edta4? (aq)b. cu(h2o)62+(aq)+3nh3(aq)? cu(h2o)3(nh3)32+(aq)+3h2o(l)c. co(nh3)4(acac)3+(aq)+2acac(aq)? co(acac)33+(aq)+3nh3(aq)d. zncl2(en)(aq)+4oh? (aq)? zn(oh)2? 4(aq)+2cl? (aq)+en(aq)e. fecl64? (aq)+edta4? (aq)? feedta2? (aq)+6cl? (aq)

each  column  of the  table  is called a group. elements in a group share similar properties. groups are  read  from  top  to  bottom. metal. metalloid. nonmetal. solid. liquid. gas. fe. hg. o.  2. 3. 4. 5. 6. 7. 8. 9.  2. beryllium. 9.012. 4.  sodium. 22.990.  11. 3.  magnesium. 24.305.  12.  potassium. 39.098.  19. 4.  calcium. 40.078.  20. i guess  i  

level 4 to level 2 : ))

on passing the small ampere of electric current through the tube made of ar and hg of cfl generates uv rays which excites the fluorescent and thus emits the high radiation by consumption of just 5- 12 w in comparison to incandescent light which requires more power such as around 40 - 55 w to lighten.

moreover the life span of fluorescent or cfl is around 8000 h whereas the life span of incandescent is around 1200 h

hence, the building installed with incandescent lights bears more electricity bill.