When comparing the ir spectra of the two compounds below, what absorption(s) would allow you to distinguish the compounds? hc≡cch2n(ch2ch3)2andch3(ch2)5c≡n strong, broad peak at 3600−3200 cm−1 medium peak at 3500−3200 cm−1 medium peak at 3300 cm−1 medium peak at 3150−3000 cm−1 strong peak at 3000−2850 cm−1 medium peak at 2250 cm−1 strong peak at ~1700 cm−1 medium peak at at 1650 cm−1 medium peak at 1600, 1500 cm−1 no distinguishing peaks

Conservation efforts have been effective in "increasing the number of endangered species, reducing all the negative impacts of human activity, and preserving wildlife habitats".hope my answer has you : ) 

The se-ci  bonds is more polar  than s-br bond

Answer(false);

Van der waals forces are temporary electromagnetic forces established between uncharged atoms. some neutral molecules, when close together, can become temporarily “charged,” as electrons move around the atom. water is a polar molecule, the side of the molecule that the hydrogens bond to being more positive, and the opposite side bound to the lone pairs of electrons being more negative. this means that it participates in dipole-dipole interaction (non-polar exhibits dispersion forces), and it has the capacity for hydrogen bonding.