Feso4+hno3+h2so4-fe2(so4)3@+no2+h2o
how to solve it by partial equation

Which of the following signs of a chemical reaction are observed in the reaction of potassium with water? precipitate formed temperature change smell produced gas produced color change

The diagrams show objects’ gravitational pull toward each other. which statement describes the relationship between diagram x and y? gravity attracts only larger objects toward one another. gravity attracts larger objects only if they are close to one another. if the masses of the objects increase, then the force between them also increases. if distance between the objects increases, then the amount of force also increases.

Which of the following would have less momentum than a 52 kg cheetah running at 10 m/s?